CAS 912569-71-2
:3-(1H-Imidazol-5-yl)benzoic acid
Description:
3-(1H-Imidazol-5-yl)benzoic acid, identified by its CAS number 912569-71-2, is an organic compound characterized by the presence of both a benzoic acid moiety and an imidazole ring. This compound features a carboxylic acid functional group (-COOH) attached to a benzene ring, which is further substituted with an imidazole group at the meta position. The imidazole ring contributes to the compound's potential biological activity, as imidazole derivatives are often found in various pharmaceuticals and biologically active molecules. The presence of the carboxylic acid group enhances its solubility in polar solvents and allows for potential interactions through hydrogen bonding. Additionally, the compound may exhibit properties such as acidity, which can influence its reactivity and interactions in chemical reactions. Overall, 3-(1H-Imidazol-5-yl)benzoic acid is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c13-10(14)8-3-1-2-7(4-8)9-5-11-6-12-9/h1-6H,(H,11,12)(H,13,14)
InChI key:InChIKey=BHMXPHTWXBSXAP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CN=CN2
Synonyms:- Benzoic acid, 3-(1H-imidazol-5-yl)-
- Benzoic acid, 3-(1H-imidazol-4-yl)-
- 3-(1H-Imidazol-5-yl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(1H-Imidazol-4-yl)benzoic acid
CAS:3-(1H-Imidazol-4-yl)benzoic acid belongs to the class of organic compounds called carboxylic acids. It is a white crystalline solid that is soluble in water and alcohol. 3-(1H-Imidazol-4-yl)benzoic acid has been used as a starting material for the synthesis of polymers, such as poly(2,6-dimethylbenzoxazole) and poly(3,5-dimethylthiophene). 3-(1H-Imidazol-4-yl)benzoic acid also emits light under ultraviolet irradiation. The emission spectra consist of two bands at 400 nm and 480 nm with a maximum at 450 nm. The molecular structure of 3-(1H-imidazol-4-yl)benzoic acid consists of three benzene rings, one NH group and one CO group.Formula:C10H8N2O2Purity:Min. 95%Molecular weight:188.18 g/mol

