
CAS 91270-62-1
:(2E)-4-(Methylphenylamino)-4-oxo-2-butenoic acid
Description:
(2E)-4-(Methylphenylamino)-4-oxo-2-butenoic acid, with the CAS number 91270-62-1, is an organic compound characterized by its unique structural features. It contains a butenoic acid backbone, which is a conjugated system featuring a double bond and a carbonyl group, contributing to its reactivity and potential biological activity. The presence of a methylphenylamino group indicates that it has an aromatic amine functionality, which can influence its solubility and interaction with biological targets. This compound is likely to exhibit properties typical of both carboxylic acids and amines, such as acidity and the ability to form hydrogen bonds. Its structural configuration suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further empirical studies. The compound's stability, reactivity, and potential applications can be influenced by factors such as pH, solvent, and temperature, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-12(9-5-3-2-4-6-9)10(13)7-8-11(14)15/h2-8H,1H3,(H,14,15)/b8-7+
InChI key:InChIKey=DGYPFFQJGDMQMT-BQYQJAHWSA-N
SMILES:N(C(/C=C/C(O)=O)=O)(C)C1=CC=CC=C1
Synonyms:- NSC 159918
- N-Methylfumaranilic acid
- 2-Butenoic acid, 4-(methylphenylamino)-4-oxo-, (E)-
- (2E)-4-(Methylphenylamino)-4-oxo-2-butenoic acid
- 2-Butenoic acid, 4-(methylphenylamino)-4-oxo-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.