CAS 91271-58-8
:2-(1-Pyrrolidinylmethyl)benzenemethanol
Description:
2-(1-Pyrrolidinylmethyl)benzenemethanol, identified by its CAS number 91271-58-8, is an organic compound characterized by its structure, which features a benzene ring substituted with a pyrrolidinylmethyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in polar solvents due to the presence of the hydroxymethyl group. The pyrrolidine moiety may contribute to its basicity and potential interactions with biological systems, making it of interest in medicinal chemistry. The compound may also display moderate to high lipophilicity, influencing its pharmacokinetic properties. Additionally, it may participate in hydrogen bonding due to the hydroxyl group, affecting its reactivity and interactions with other molecules. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(1-Pyrrolidinylmethyl)benzenemethanol represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c14-10-12-6-2-1-5-11(12)9-13-7-3-4-8-13/h1-2,5-6,14H,3-4,7-10H2
InChI key:InChIKey=PFXHKECPFIBDRU-UHFFFAOYSA-N
SMILES:C(C1=C(CO)C=CC=C1)N2CCCC2
Synonyms:- 2-(1-Pyrrolidinylmethyl)benzenemethanol
- Benzenemethanol, 2-(1-pyrrolidinylmethyl)-
- Benzyl alcohol, o-(1-pyrrolidinylmethyl)-
- NSC 175205
- [2-[(Pyrrolidin-1-yl)methyl]phenyl]methanol
- [2-(Pyrrolidin-1-ylmethyl)phenyl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.