CAS 91271-80-6

1-[3-(piperidin-1-ylmethyl)phenyl]methanamine

Description:

1-[3-(Piperidin-1-ylmethyl)phenyl]methanamine, with the CAS number 91271-80-6, is a chemical compound characterized by its amine functional group and a piperidine ring. This substance features a phenyl group attached to a methanamine moiety, which is further substituted with a piperidinylmethyl group. The presence of the piperidine ring contributes to its potential as a pharmacological agent, as piperidine derivatives are often associated with various biological activities, including analgesic and antidepressant effects. The compound is likely to exhibit moderate to high solubility in polar solvents due to its amine functionality, which can engage in hydrogen bonding. Additionally, its structural features suggest that it may interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with amine groups, which can be reactive. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.

Formula: C₁₃H₂₀N₂

InChI: InChI=1/C13H20N2/c14-10-12-5-4-6-13(9-12)11-15-7-2-1-3-8-15/h4-6,9H,1-3,7-8,10-11,14H2

SMILES: C1CCN(CC1)Cc1cccc(c1)CN

Synonyms:

• Benzenemethanamine, 3-(1-Piperidinylmethyl)-
• 1-[3-(Piperidin-1-ylmethyl)phenyl]methanamine