CAS 912758-00-0
:S-Diclofenac
Description:
S-Diclofenac, with the CAS number 912758-00-0, is a non-steroidal anti-inflammatory drug (NSAID) that is a chiral derivative of diclofenac. It primarily exhibits analgesic, anti-inflammatory, and antipyretic properties, making it effective in treating conditions such as arthritis, pain, and inflammation. S-Diclofenac is characterized by its ability to inhibit cyclooxygenase (COX) enzymes, which play a crucial role in the biosynthesis of prostaglandins, mediators of inflammation and pain. The S-enantiomer is often associated with enhanced therapeutic effects and reduced side effects compared to its racemic counterpart. In terms of physical properties, S-Diclofenac is typically a white to off-white crystalline powder, with moderate solubility in water and higher solubility in organic solvents. Its pharmacokinetics involve absorption through the gastrointestinal tract, with metabolism primarily occurring in the liver. As with other NSAIDs, potential side effects may include gastrointestinal discomfort, cardiovascular risks, and renal impairment, necessitating careful consideration in clinical use.
Formula:C23H15Cl2NO2S3
InChI:InChI=1S/C23H15Cl2NO2S3/c24-17-5-3-6-18(25)23(17)26-19-7-2-1-4-15(19)12-21(27)28-16-10-8-14(9-11-16)20-13-22(29)31-30-20/h1-11,13,26H,12H2
InChI key:InChIKey=BRDUXOHVEZVAHI-UHFFFAOYSA-N
SMILES:N(C1=C(CC(OC2=CC=C(C=C2)C=3SSC(=S)C3)=O)C=CC=C1)C4=C(Cl)C=CC=C4Cl
Synonyms:- ACS 15
- Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-, 4-(3-thioxo-3H-1,2-dithiol-5-yl)phenyl ester
- ATB 337
- S-Diclofenac
- BRDUXOHVEZVAHI-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ATB-337
CAS:S-Diclofenac, an NSAID with H2S-releasing moiety, protects gastric mucosa while inhibiting prostaglandins.Formula:C23H15Cl2NO2S3Color and Shape:SolidMolecular weight:504.47
