CAS 912760-87-3
:Ethyl 3-(4-amino-5-bromo-3-pyridyl)acrylate
Description:
Ethyl 3-(4-amino-5-bromo-3-pyridyl)acrylate is an organic compound characterized by its structure, which includes an ethyl ester group and a pyridine ring substituted with an amino and bromo group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the pyridine moiety, which can enhance biological activity. The amino group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the bromine atom can serve as a site for further functionalization, allowing for the creation of more complex molecules. Ethyl 3-(4-amino-5-bromo-3-pyridyl)acrylate is likely to be soluble in organic solvents and may exhibit moderate stability under standard laboratory conditions. However, like many organic compounds, it should be handled with care, considering potential toxicity and reactivity.
Formula:C10H11BrN2O2
InChI:InChI=1/C10H11BrN2O2/c1-2-15-9(14)4-3-7-5-13-6-8(11)10(7)12/h3-6H,2H2,1H3,(H2,12,13)
SMILES:CCOC(=O)C=Cc1c[nH]cc(c1=N)Br
Synonyms:- Ethyl 3-(4-Amino-5-Bromo-3-Pyridyl)Prop-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
