CymitQuimica logo

CAS 912760-91-9

:

Ethyl 3-(2-methoxy-3-pyridyl)acrylate

Description:
Ethyl 3-(2-methoxy-3-pyridyl)acrylate is an organic compound characterized by its ester functional group, which is derived from the reaction of an acrylic acid and an alcohol. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Ethyl 3-(2-methoxy-3-pyridyl)acrylate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and a distinct odor. It is soluble in common organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic characteristics. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-3-15-10(13)7-6-9-5-4-8-12-11(9)14-2/h4-8H,3H2,1-2H3
SMILES:CCOC(=O)C=Cc1cccnc1OC
Synonyms:
  • Ethyl 3-(2-Methoxy-3-Pyridyl)Prop-2-Enoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.