CAS 912761-41-2
:N-Cyclopropyl-2-(4-piperidinyloxy)acetamide
Description:
N-Cyclopropyl-2-(4-piperidinyloxy)acetamide, identified by its CAS number 912761-41-2, is a chemical compound that features a cyclopropyl group and a piperidine moiety, which contribute to its unique properties. This substance is characterized by its amide functional group, which typically imparts stability and influences its solubility and reactivity. The presence of the piperidinyloxy group suggests potential interactions with biological systems, making it of interest in medicinal chemistry, particularly for its possible pharmacological activities. The cyclopropyl ring can enhance the compound's lipophilicity and may affect its binding affinity to biological targets. Additionally, the structural features of this compound may allow for specific conformational flexibility, which can be crucial in drug design. Overall, N-Cyclopropyl-2-(4-piperidinyloxy)acetamide represents a compound with potential applications in therapeutic contexts, warranting further investigation into its biological effects and mechanisms of action.
Formula:C10H18N2O2
InChI:InChI=1/C10H18N2O2/c13-10(12-8-1-2-8)7-14-9-3-5-11-6-4-9/h8-9,11H,1-7H2,(H,12,13)
SMILES:C1CC1N=C(COC1CCNCC1)O
Synonyms:- acetamide, N-cyclopropyl-2-(4-piperidinyloxy)-
- N-cyclopropyl-2-(piperidin-4-yloxy)acetamide
- N-cyclopropyl-2-(4-piperidyloxy)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
