CAS 912761-48-9
:4-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidine
Description:
4-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and an oxadiazole moiety. The piperidine ring is a six-membered saturated heterocycle containing one nitrogen atom, contributing to the compound's basicity and potential for forming hydrogen bonds. The oxadiazole part, specifically the 1,2,4-oxadiazole, is a five-membered ring containing two nitrogen atoms and is known for its stability and ability to participate in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as solubility, melting point, and reactivity, can be influenced by the presence of the ethyl group on the oxadiazole, which can affect its lipophilicity and interaction with biological targets. Overall, 4-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its potential uses and mechanisms of action.
Formula:C9H15N3O
InChI:InChI=1/C9H15N3O/c1-2-8-11-9(13-12-8)7-3-5-10-6-4-7/h7,10H,2-6H2,1H3
SMILES:CCc1nc(C2CCNCC2)on1
Synonyms:- Piperidine, 4-(3-Ethyl-1,2,4-Oxadiazol-5-Yl)-
- 4-(3-Ethyl-1,2,4-oxadiazol-5-yl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
