CAS 912761-67-2
:N-(1,1-Dimethylethyl)-2-(4-piperidinyloxy)acetamide
Description:
N-(1,1-Dimethylethyl)-2-(4-piperidinyloxy)acetamide, identified by its CAS number 912761-67-2, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which contributes to its potential biological activity, and an acetamide functional group that enhances its solubility and reactivity. The presence of the tert-butyl group (1,1-dimethylethyl) provides steric hindrance, which can influence the compound's interaction with biological targets. This compound is often studied for its pharmacological properties, particularly in the context of its role as a potential drug candidate. Its molecular structure suggests that it may exhibit properties such as lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the piperidinyloxy moiety may impart antioxidant or radical-scavenging capabilities. Overall, the characteristics of this compound make it of interest in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation.
Formula:C11H22N2O2
InChI:InChI=1S/C11H22N2O2/c1-11(2,3)13-10(14)8-15-9-4-6-12-7-5-9/h9,12H,4-8H2,1-3H3,(H,13,14)
InChI key:InChIKey=GVZIFIHCXVTZKY-UHFFFAOYSA-N
SMILES:O(CC(NC(C)(C)C)=O)C1CCNCC1
Synonyms:- Acetamide, N-(1,1-dimethylethyl)-2-(4-piperidinyloxy)-
- N-(1,1-Dimethylethyl)-2-(4-piperidinyloxy)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.