CymitQuimica logo

CAS 912761-82-1

:

3-Iodo-2-(2,2,2-trifluoroethoxy)pyridine

Description:
3-Iodo-2-(2,2,2-trifluoroethoxy)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an iodine atom at the 3-position of the pyridine ring contributes to its reactivity, particularly in nucleophilic substitution reactions. The 2-(2,2,2-trifluoroethoxy) substituent introduces a trifluoromethyl group, which enhances the compound's lipophilicity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms, which can affect its solubility in various solvents. Additionally, the trifluoroethoxy group may impart unique properties, such as increased stability and altered electronic characteristics. Overall, 3-Iodo-2-(2,2,2-trifluoroethoxy)pyridine is of interest in medicinal chemistry and materials science, where its unique structural features can be leveraged for the development of pharmaceuticals or functional materials.
Formula:C7H5F3INO
InChI:InChI=1/C7H5F3INO/c8-7(9,10)4-13-6-5(11)2-1-3-12-6/h1-3H,4H2
SMILES:c1cc(c(nc1)OCC(F)(F)F)I
Synonyms:
  • Pyridine, 3-Iodo-2-(2,2,2-Trifluoroethoxy)-
  • 3-IODO-2-(2,2,2-TRIFLUORO-ETHOXY)-PYRIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.