CymitQuimica logo

CAS 912761-86-5

:

[2-fluoro-4-(trifluoromethyl)phenyl]hydrazine

Description:
[2-Fluoro-4-(trifluoromethyl)phenyl]hydrazine is an organic compound characterized by its hydrazine functional group attached to a phenyl ring that features both a fluorine and a trifluoromethyl substituent. The presence of the fluorine atom at the ortho position and the trifluoromethyl group at the para position significantly influences its chemical properties, including its reactivity and polarity. This compound is likely to exhibit hydrazine-like behavior, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitutions. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the compound's structure suggests potential applications in materials science and as an intermediate in the synthesis of more complex molecules. Safety considerations are important, as hydrazines are generally considered hazardous, requiring careful handling and storage. Overall, [2-fluoro-4-(trifluoromethyl)phenyl]hydrazine presents a unique combination of properties that can be leveraged in various chemical contexts.
Formula:C7H6F4N2
InChI:InChI=1/C7H6F4N2/c8-5-3-4(7(9,10)11)1-2-6(5)13-12/h1-3,13H,12H2
SMILES:c1cc(c(cc1C(F)(F)F)F)NN
Synonyms:
  • Hydrazine, [2-Fluoro-4-(Trifluoromethyl)Phenyl]-
  • [2-Fluoro-4-(trifluoromethyl)phenyl]hydrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.