CAS 912762-30-2
:Pyrazine, 2-chloro-5-(2-thienyl)-
Description:
Pyrazine, 2-chloro-5-(2-thienyl)- is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at opposite positions. The presence of a chlorine atom at the 2-position and a thienyl group at the 5-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It may participate in various chemical reactions due to the reactivity of the chlorine atom, which can undergo nucleophilic substitution. The thienyl group, derived from thiophene, introduces additional reactivity and can influence the compound's electronic properties. Pyrazine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their ability to interact with biological systems and their role in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H5ClN2S
InChI:InChI=1S/C8H5ClN2S/c9-8-5-10-6(4-11-8)7-2-1-3-12-7/h1-5H
InChI key:InChIKey=XZYCGRPUJHTKAW-UHFFFAOYSA-N
SMILES:ClC=1N=CC(=NC1)C2=CC=CS2
Synonyms:- 2-Chlor-5-(2-thienyl)pyrazin
- 2-Chloro-5-(thien-2-yl)pyrazine
- 2-Chloro-5-(thiophen-2-yl)pyrazine
- 2-Chloro-5-thiophen-2-ylpyrazine
- Pyrazine, 2-Chloro-5-(2-Thienyl)-
- 2-Chloro-5-(2-thienyl)pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
