CAS 912762-82-4

tert-butyl [2-amino-2-(4-methoxyphenyl)ethyl]carbamate

Description:

Tert-butyl [2-amino-2-(4-methoxyphenyl)ethyl]carbamate, with the CAS number 912762-82-4, is an organic compound characterized by its carbamate functional group. This substance features a tert-butyl group, which contributes to its steric bulk and hydrophobic properties, enhancing its solubility in organic solvents. The presence of the 4-methoxyphenyl moiety introduces an aromatic character, which can influence its reactivity and interaction with biological systems. The amino group in the structure suggests potential for hydrogen bonding and reactivity in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drug candidates. Its stability, solubility, and reactivity can be influenced by the surrounding functional groups, making it a versatile compound in synthetic organic chemistry. Proper handling and storage conditions are essential due to potential reactivity, and safety data sheets should be consulted for specific safety measures.

Formula: C₁₄H₂₂N₂O₃

InChI: InChI=1/C14H22N2O3/c1-14(2,3)19-13(17)16-9-12(15)10-5-7-11(18-4)8-6-10/h5-8,12H,9,15H2,1-4H3,(H,16,17)

SMILES: CC(C)(C)OC(=NCC(c1ccc(cc1)OC)N)O

Synonyms:

• tert-Butyl [2-amino-2-(4-methoxyphenyl)ethyl]carbamate

tert-butyl N-[2-amino-2-(4-methoxyphenyl)ethyl]carbamate

CAS: 912762-82-4

Formula: C₁₄H₂₂N₂O₃

Purity: 95.0%

Molecular weight: 266.341

Ref: 10-F526492