CAS 912763-31-6
:1-methylsulfonyl-3-phenyl-piperazine
Description:
1-Methylsulfonyl-3-phenyl-piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a methylsulfonyl group (-SO2CH3) at the 1-position and a phenyl group at the 3-position contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in various organic solvents, which is common for piperazine derivatives. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The structure allows for potential interactions with biological targets, influencing its pharmacological profile. As with many piperazine derivatives, it may also possess psychoactive properties, although specific effects would depend on its interaction with neurotransmitter systems. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1-methylsulfonyl-3-phenyl-piperazine represents a versatile compound with applications in research and drug development.
Formula:C11H16N2O2S
InChI:InChI=1/C11H16N2O2S/c1-16(14,15)13-8-7-12-11(9-13)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3
SMILES:CS(=O)(=O)N1CCNC(C1)c1ccccc1
Synonyms:- 1-(Methylsulfonyl)-3-phenylpiperazin
- 1-(Methylsulfonyl)-3-phenylpiperazine
- Piperazine, 1-(Methylsulfonyl)-3-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.