CAS 912763-39-4

5-(2-methoxyphenyl)-1H-pyrazin-2-one

Description:

5-(2-Methoxyphenyl)-1H-pyrazin-2-one is an organic compound characterized by its pyrazinone structure, which features a pyrazine ring fused with a carbonyl group. This compound contains a methoxyphenyl substituent at the 5-position of the pyrazinone, contributing to its unique chemical properties. It typically exhibits moderate to high solubility in organic solvents due to the presence of the methoxy group, which enhances its lipophilicity. The compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, and it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. The presence of the pyrazinone moiety suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c1-15-10-5-3-2-4-8(10)9-6-13-11(14)7-12-9/h2-7H,1H3,(H,13,14)

SMILES: COc1ccccc1c1c[nH]c(=O)cn1

Synonyms:

• 2(1H)-pyrazinone, 5-(2-methoxyphenyl)-
• 5-(2-Methoxyphenyl)-2(1H)-pyrazinon
• 5-(2-Methoxyphenyl)-2(1H)-pyrazinone
• 5-(2-Methoxyphenyl)pyrazin-2(1H)-one