CAS 912763-41-8
:2-phenyl-5-pyrrolidin-1-yl-pyrazine
Description:
2-Phenyl-5-pyrrolidin-1-yl-pyrazine is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a phenyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the pyrrolidine ring may impart certain pharmacological properties, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the influence of its aromatic and heteroaromatic components. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity may be influenced by the electronic effects of the substituents on the pyrazine ring. Overall, 2-phenyl-5-pyrrolidin-1-yl-pyrazine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C14H15N3
InChI:InChI=1/C14H15N3/c1-2-6-12(7-3-1)13-10-16-14(11-15-13)17-8-4-5-9-17/h1-3,6-7,10-11H,4-5,8-9H2
Synonyms:- 2-Phenyl-5-(1-pyrrolidinyl)pyrazin
- pyrazine, 2-phenyl-5-(1-pyrrolidinyl)-
- 2-phenyl-5-(pyrrolidin-1-yl)pyrazine
- 2-Phenyl-5-(1-pyrrolidinyl)pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.