CAS 912763-51-0

4-chloro-N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]benzamide

Description:

4-Chloro-N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]benzamide is a chemical compound characterized by its complex structure, which includes a chloro group, a benzamide moiety, and a cyclohexyl group substituted with a hydroxycarbamimidoyl functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxy and amide functionalities, which can engage in hydrogen bonding. The chloro substituent may influence its reactivity and biological activity, potentially enhancing its interaction with biological targets. The presence of the hydroxycarbamimidoyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit enzyme inhibition or modulation properties. Additionally, the cyclohexyl ring contributes to the compound's steric properties, which can affect its binding affinity and selectivity towards specific biological receptors. Overall, this compound's unique structural features make it a subject of interest in chemical and pharmaceutical research.

Formula: C₁₄H₁₈ClN₃O₂

InChI: InChI=1/C14H18ClN3O2/c15-11-6-4-10(5-7-11)12(19)17-14(13(16)18-20)8-2-1-3-9-14/h4-7,20H,1-3,8-9H2,(H2,16,18)(H,17,19)

Synonyms:

• 4-Chloro-N-[1-(N-hydroxycarbamimidoyl)cyclohexyl]benzamide
• 4-Chlor-N-[1-(N-hydroxycarbamimidoyl)cyclohexyl]benzamid
• 4-Chloro-N-[1-(N'-hydroxycarbamimidoyl)cyclohexyl]benzamide