CAS 912763-52-1

5-(2-Fluorophenyl)-1H-imidazole

Description:

5-(2-Fluorophenyl)-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a 2-fluorophenyl group at the 5-position of the imidazole ring introduces both electron-withdrawing and steric effects, influencing the compound's reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific structure and substituents. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the imidazole moiety's role in biological systems and its ability to interact with various biological targets. The fluorine atom can enhance the compound's metabolic stability and lipophilicity, making it a valuable candidate in drug design. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₉H₇FN₂

InChI: InChI=1S/C9H7FN2/c10-8-4-2-1-3-7(8)9-5-11-6-12-9/h1-6H,(H,11,12)

InChI key: InChIKey=PXQYPFPWPCQOTB-UHFFFAOYSA-N

SMILES: FC1=C(C2=CN=CN2)C=CC=C1

Synonyms:

• 1H-Imidazole, 4-(2-fluorophenyl)-
• 5-(2-Fluorophenyl)-1H-imidazole
• 1H-Imidazole, 5-(2-fluorophenyl)-