CymitQuimica logo

CAS 912763-54-3

:

4-chloro-N-[1-(N'-hydroxycarbamimidoyl)cycloheptyl]benzamide

Description:
4-Chloro-N-[1-(N'-hydroxycarbamimidoyl)cycloheptyl]benzamide is a chemical compound characterized by its complex structure, which includes a chloro substituent on a benzamide moiety and a cycloheptyl group linked to a hydroxycarbamimidoyl functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chloro group may influence its reactivity and solubility, while the hydroxycarbamimidoyl group can impart specific interactions with biological targets, such as enzymes or receptors. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its potential applications in medicinal chemistry. Additionally, the cycloheptyl ring may provide steric hindrance, affecting the compound's binding affinity and selectivity. Overall, this compound's unique characteristics make it a subject of interest in pharmaceutical research, particularly in the development of novel therapeutic agents.
Formula:C15H20ClN3O2
InChI:InChI=1/C15H20ClN3O2/c16-12-7-5-11(6-8-12)13(20)18-15(14(17)19-21)9-3-1-2-4-10-15/h5-8,21H,1-4,9-10H2,(H2,17,19)(H,18,20)
Synonyms:
  • 4-Chloro-N-[1-(N-hydroxycarbamimidoyl)cycloheptyl]benzamide
  • 4-Chlor-N-[1-(N-hydroxycarbamimidoyl)cycloheptyl]benzamid
  • 4-Chloro-N-[1-(N'-hydroxycarbamimidoyl)cycloheptyl]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.