CAS 912763-62-3

2,6-dichloro-N-(1-cyanocycloheptyl)benzamide

Description:

2,6-Dichloro-N-(1-cyanocycloheptyl)benzamide is a chemical compound characterized by its unique structure, which includes a benzamide moiety substituted with two chlorine atoms at the 2 and 6 positions of the aromatic ring, and a cyanocycloheptyl group attached to the nitrogen atom. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the cyano group introduces polar characteristics, which can influence its reactivity and interactions with biological systems. The dichloro substitution can enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties. As a benzamide derivative, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure risks, as halogenated compounds can pose environmental and health hazards. Overall, 2,6-dichloro-N-(1-cyanocycloheptyl)benzamide represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₅H₁₆Cl₂N₂O

InChI: InChI=1/C15H16Cl2N2O/c16-11-6-5-7-12(17)13(11)14(20)19-15(10-18)8-3-1-2-4-9-15/h5-7H,1-4,8-9H2,(H,19,20)

Synonyms:

• benzamide, 2,6-dichloro-N-(1-cyanocycloheptyl)-
• 2,6-Dichlor-N-(1-cyancycloheptyl)benzamid