
CAS 912763-68-9
:5-(4-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde
Description:
5-(4-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, enhancing the compound's electronic properties and potentially influencing its reactivity and biological activity. The aldehyde functional group (-CHO) at the 2-position of the pyrrole ring contributes to its reactivity, making it a useful intermediate in organic synthesis. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, which can be explored in medicinal chemistry. Its molecular structure allows for various applications, including in the development of pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, 5-(4-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde represents a versatile building block in synthetic organic chemistry.
Formula:C11H8FNO
InChI:InChI=1S/C11H8FNO/c12-9-3-1-8(2-4-9)11-6-5-10(7-14)13-11/h1-7,13H
InChI key:InChIKey=NFUXIXPXPWWFCY-UHFFFAOYSA-N
SMILES:C(=O)C=1NC(=CC1)C2=CC=C(F)C=C2
Synonyms:- 5-(4-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde
- 1H-Pyrrole-2-carboxaldehyde, 5-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.