CAS 912763-76-9

5-(3-Chlorophenyl)-1H-pyrrole-2-carboxaldehyde

Description:

5-(3-Chlorophenyl)-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The 3-chlorophenyl substituent enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its properties can be influenced by the presence of the chlorine atom, which can affect electronic distribution and steric hindrance. Additionally, the compound may exhibit fluorescence or other photophysical properties, depending on its molecular structure and environment. Its synthesis and characterization are important for applications in drug development and as a building block in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₈ClNO

InChI: InChI=1S/C11H8ClNO/c12-9-3-1-2-8(6-9)11-5-4-10(7-14)13-11/h1-7,13H

InChI key: InChIKey=FPHMYBIJNRKAST-UHFFFAOYSA-N

SMILES: C(=O)C=1NC(=CC1)C2=CC(Cl)=CC=C2

Synonyms:

• 1H-Pyrrole-2-carboxaldehyde, 5-(3-chlorophenyl)-
• 5-(3-Chlorophenyl)-1H-pyrrole-2-carboxaldehyde