CymitQuimica logo

CAS 912763-77-0

:

1-[(2,6-dichlorobenzoyl)amino]cycloheptane-1-carboxylic acid

Description:
1-[(2,6-Dichlorobenzoyl)amino]cycloheptane-1-carboxylic acid is a chemical compound characterized by its unique structure, which includes a cycloheptane ring, an amino group, and a carboxylic acid functional group. The presence of the 2,6-dichlorobenzoyl moiety contributes to its potential biological activity and lipophilicity. This compound is likely to exhibit moderate to high solubility in organic solvents due to its aromatic and aliphatic components, while its carboxylic acid group may impart some degree of hydrophilicity. The dichlorobenzoyl group can influence the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the cycloheptane ring provides a unique three-dimensional conformation that may affect the compound's pharmacokinetics and pharmacodynamics. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways or receptors. However, further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H17Cl2NO3
InChI:InChI=1/C15H17Cl2NO3/c16-10-6-5-7-11(17)12(10)13(19)18-15(14(20)21)8-3-1-2-4-9-15/h5-7H,1-4,8-9H2,(H,18,19)(H,20,21)
Synonyms:
  • 1-[(2,6-Dichlorobenzoyl)amino]cycloheptanecarboxylic acid
  • Acide 1-[(2,6-dichlorobenzoyl)amino]cycloheptanecarboxylique
  • cycloheptanecarboxylic acid, 1-[(2,6-dichlorobenzoyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.