
CAS 912763-99-6
:5-(2-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde
Description:
5-(2-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The fluorophenyl substituent enhances its electronic properties, potentially influencing its reactivity and interactions with biological targets. This compound may exhibit interesting pharmacological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its unique combination of functional groups can lead to diverse applications in organic synthesis and material science. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling and usage, as with any chemical substance. Overall, 5-(2-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde represents a versatile building block in organic synthesis and drug development.
Formula:C11H8FNO
InChI:InChI=1S/C11H8FNO/c12-10-4-2-1-3-9(10)11-6-5-8(7-14)13-11/h1-7,13H
InChI key:InChIKey=XAZQBICSDXRPGX-UHFFFAOYSA-N
SMILES:FC1=C(C=2NC(C=O)=CC2)C=CC=C1
Synonyms:- 5-(2-Fluorophenyl)-1H-pyrrole-2-carboxaldehyde
- 1H-Pyrrole-2-carboxaldehyde, 5-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.