CymitQuimica logo

CAS 912768-88-8

:

tert-butyl 4-(3-chlorobenzoyl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(3-chlorobenzoyl)piperidine-1-carboxylate is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing ring. The structure features a tert-butyl ester group, enhancing its lipophilicity and potentially influencing its pharmacokinetic properties. The presence of a 3-chlorobenzoyl moiety introduces a chlorinated aromatic system, which can affect the compound's reactivity and biological activity. This compound is typically used in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. Additionally, the chlorobenzoyl group may impart specific interactions with biological targets, making it of interest in drug development. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose environmental and health risks.
Formula:C17H22ClNO3
InChI:InChI=1/C17H22ClNO3/c1-17(2,3)22-16(21)19-9-7-12(8-10-19)15(20)13-5-4-6-14(18)11-13/h4-6,11-12H,7-10H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)C(=O)c1cccc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.