CAS 912770-34-4

6-(4-chlorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid

Description:

6-(4-Chlorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid is a heterocyclic compound characterized by its imidazo-thiazole core structure, which incorporates both nitrogen and sulfur atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential for forming salts or esters. The presence of a 4-chlorophenyl substituent enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its unique arrangement of atoms and functional groups may also impart specific reactivity patterns, making it suitable for various chemical reactions. Additionally, the compound's stability, solubility, and interaction with biological targets can be influenced by its molecular characteristics, which are essential for understanding its behavior in biological systems and potential applications in drug design. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications for both synthetic and medicinal chemistry.

Formula: C₁₂H₇ClN₂O₂S

InChI: InChI=1/C12H7ClN2O2S/c13-8-3-1-7(2-4-8)9-5-15-10(11(16)17)6-18-12(15)14-9/h1-6H,(H,16,17)

SMILES: c1cc(ccc1c1cn2c(csc2n1)C(=O)O)Cl

6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid

CAS: 912770-34-4

Molecular weight: 278.7099914550781

Ref: 10-F366846