CAS 912770-37-7
:6-(4-fluorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid
Description:
6-(4-Fluorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid is a heterocyclic compound characterized by its imidazo-thiazole core, which incorporates both nitrogen and sulfur atoms in its structure. The presence of the 4-fluorophenyl group enhances its chemical properties, potentially influencing its reactivity and biological activity. This compound features a carboxylic acid functional group, which contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. The fluorine atom in the phenyl ring may enhance lipophilicity and affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the imidazo-thiazole framework is often associated with diverse pharmacological activities, including antimicrobial and anticancer properties. The compound's molecular structure allows for potential applications in drug development, particularly in targeting specific biological pathways. Overall, 6-(4-fluorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid exemplifies a class of compounds that bridge organic chemistry and pharmacology, warranting further investigation for therapeutic uses.
Formula:C12H7FN2O2S
InChI:InChI=1/C12H7FN2O2S/c13-8-3-1-7(2-4-8)9-5-15-10(11(16)17)6-18-12(15)14-9/h1-6H,(H,16,17)
SMILES:c1cc(ccc1c1cn2c(csc2n1)C(=O)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.