CAS 912770-75-3
:1-[[2-(2-thienyl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-3-carboxylic acid
Description:
1-[[2-(2-thienyl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-3-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring, an imidazo-pyridine moiety, and a thienyl group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity due to its intricate molecular architecture. The presence of the carboxylic acid functional group suggests it may engage in hydrogen bonding and ionic interactions, which can influence its reactivity and interactions with biological targets. Additionally, the thienyl and imidazo-pyridine components may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular weight, melting point, and specific reactivity would depend on its precise structural configuration and purity. Overall, this substance is likely to be studied for its potential applications in drug development or as a biochemical probe, given its diverse functional groups and structural complexity.
Formula:C18H19N3O2S
InChI:InChI=1/C18H19N3O2S/c22-18(23)13-5-3-8-20(11-13)12-14-17(15-6-4-10-24-15)19-16-7-1-2-9-21(14)16/h1-2,4,6-7,9-10,13H,3,5,8,11-12H2,(H,22,23)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.