CAS 912770-78-6
:1-[[2-(2-thienyl)imidazo[3,2-a]pyrimidin-3-yl]methyl]piperidine-3-carboxylic acid
Description:
1-[[2-(2-thienyl)imidazo[3,2-a]pyrimidin-3-yl]methyl]piperidine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, an imidazo-pyrimidine moiety, and a thienyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents depending on its functional groups. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, potentially acting as a weak acid. Its imidazo and pyrimidine components may contribute to biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The thienyl group can enhance the compound's lipophilicity and influence its interaction with biological targets. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in drug discovery and development contexts.
Formula:C17H18N4O2S
InChI:InChI=1/C17H18N4O2S/c22-16(23)12-4-1-7-20(10-12)11-13-15(14-5-2-9-24-14)19-17-18-6-3-8-21(13)17/h2-3,5-6,8-9,12H,1,4,7,10-11H2,(H,22,23)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.