CAS 912770-81-1

N-(1-cyanocyclopentyl)-3-fluoro-benzamide

Description:

N-(1-cyanocyclopentyl)-3-fluoro-benzamide is a chemical compound characterized by its unique structural features, which include a benzamide moiety substituted with a fluoro group and a cyanocyclopentyl side chain. The presence of the fluoro group typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The cyanocyclopentyl group contributes to the compound's three-dimensional conformation, potentially affecting its interaction with biological targets. This compound may exhibit specific pharmacological properties, which can be explored in drug development contexts. Additionally, the presence of both cyano and fluoro functional groups suggests potential reactivity and stability considerations in various chemical environments. As with many compounds in this class, understanding its solubility, stability, and reactivity is crucial for applications in research and industry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₃H₁₃FN₂O

InChI: InChI=1/C13H13FN2O/c14-11-5-3-4-10(8-11)12(17)16-13(9-15)6-1-2-7-13/h3-5,8H,1-2,6-7H2,(H,16,17)

SMILES: C1CCC(C1)(C#N)N=C(c1cccc(c1)F)O

Synonyms:

• benzamide, N-(1-cyanocyclopentyl)-3-fluoro-
• N-(1-Cyancyclopentyl)-3-fluorbenzamid
• N-(1-cyanocyclopentyl)-3-fluorobenzamide