CAS 912770-84-4

N-(1-cyanocyclohexyl)-3-fluoro-benzamide

Description:

N-(1-cyanocyclohexyl)-3-fluoro-benzamide is a chemical compound characterized by its unique structural features, which include a benzamide moiety substituted with a fluorine atom and a cyanocyclohexyl group. The presence of the cyanide functional group contributes to its potential reactivity and biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific interactions of its functional groups. The fluorine atom can influence the compound's lipophilicity and electronic properties, potentially affecting its pharmacokinetics and pharmacodynamics if used in medicinal chemistry. Additionally, the cyclohexyl ring provides a degree of steric hindrance, which can impact the compound's interactions with biological targets. Overall, N-(1-cyanocyclohexyl)-3-fluoro-benzamide is of interest in various fields, including pharmaceuticals and materials science, due to its distinctive chemical structure and potential applications.

Formula: C₁₄H₁₅FN₂O

InChI: InChI=1/C14H15FN2O/c15-12-6-4-5-11(9-12)13(18)17-14(10-16)7-2-1-3-8-14/h4-6,9H,1-3,7-8H2,(H,17,18)

SMILES: C1CCC(CC1)(C#N)N=C(c1cccc(c1)F)O

Synonyms:

• benzamide, N-(1-cyanocyclohexyl)-3-fluoro-
• N-(1-Cyancyclohexyl)-3-fluorbenzamid
• N-(1-cyanocyclohexyl)-3-fluorobenzamide