CAS 912770-87-7

N-(1-cyanocycloheptyl)-3-fluoro-benzamide

Description:

N-(1-cyanocycloheptyl)-3-fluoro-benzamide is a chemical compound characterized by its unique structural features, which include a benzamide moiety substituted with a fluoro group and a cyanocycloheptyl side chain. The presence of the cyano group introduces a polar functional group, enhancing the compound's potential for hydrogen bonding and influencing its solubility and reactivity. The fluorine atom, being highly electronegative, can significantly affect the compound's electronic properties, potentially increasing its lipophilicity and altering its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many organic compounds, the stability, reactivity, and biological activity of N-(1-cyanocycloheptyl)-3-fluoro-benzamide can be influenced by environmental factors such as pH and temperature, as well as by the presence of other chemical species.

Formula: C₁₅H₁₇FN₂O

InChI: InChI=1/C15H17FN2O/c16-13-7-5-6-12(10-13)14(19)18-15(11-17)8-3-1-2-4-9-15/h5-7,10H,1-4,8-9H2,(H,18,19)

SMILES: C1CCCC(CC1)(C#N)N=C(c1cccc(c1)F)O

Synonyms:

• benzamide, N-(1-cyanocycloheptyl)-3-fluoro-
• N-(1-Cyancycloheptyl)-3-fluorbenzamid
• N-(1-cyanocycloheptyl)-3-fluorobenzamide