CAS 912770-90-2
:N-[1-(aminomethyl)cyclopentyl]-3-fluoro-benzamide
Description:
N-[1-(aminomethyl)cyclopentyl]-3-fluoro-benzamide is a chemical compound characterized by its unique structural features, which include a cyclopentyl group, an amino group, and a fluorobenzamide moiety. The presence of the amino group suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The fluorine atom in the benzamide portion may enhance the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit specific pharmacological properties, potentially acting as a ligand for various biological targets. Its molecular structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and amide bond formations. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-[1-(aminomethyl)cyclopentyl]-3-fluoro-benzamide represents a class of compounds that may have applications in drug development and research, particularly in the fields of neuropharmacology and medicinal chemistry.
Formula:C13H17FN2O
InChI:InChI=1/C13H17FN2O/c14-11-5-3-4-10(8-11)12(17)16-13(9-15)6-1-2-7-13/h3-5,8H,1-2,6-7,9,15H2,(H,16,17)
SMILES:C1CCC(C1)(CN)N=C(c1cccc(c1)F)O
Synonyms:- benzamide, N-[1-(aminomethyl)cyclopentyl]-3-fluoro-
- N-[1-(Aminomethyl)cyclopentyl]-3-fluorbenzamid
- N-[1-(aminomethyl)cyclopentyl]-3-fluorobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.