CymitQuimica logo

CAS 912770-93-5

:

N-[1-(aminomethyl)cyclohexyl]-3-fluoro-benzamide

Description:
N-[1-(aminomethyl)cyclohexyl]-3-fluoro-benzamide, with the CAS number 912770-93-5, is a chemical compound characterized by its unique structure that includes a cyclohexyl group, an amino group, and a fluorobenzamide moiety. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the amino and carbonyl functional groups. The fluorine atom in the benzamide ring can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the presence of the cyclohexyl group may contribute to the compound's lipophilicity, affecting its pharmacokinetic properties. Overall, N-[1-(aminomethyl)cyclohexyl]-3-fluoro-benzamide represents a class of compounds that may have significant applications in drug discovery and development.
Formula:C14H19FN2O
InChI:InChI=1/C14H19FN2O/c15-12-6-4-5-11(9-12)13(18)17-14(10-16)7-2-1-3-8-14/h4-6,9H,1-3,7-8,10,16H2,(H,17,18)
SMILES:C1CCC(CC1)(CN)N=C(c1cccc(c1)F)O
Synonyms:
  • benzamide, N-[1-(aminomethyl)cyclohexyl]-3-fluoro-
  • N-[1-(Aminomethyl)cyclohexyl]-3-fluorbenzamid
  • N-[1-(aminomethyl)cyclohexyl]-3-fluorobenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.