CymitQuimica logo

CAS 912771-07-4

:

N-(1-cyanocyclopentyl)-2-fluoro-benzamide

Description:
N-(1-cyanocyclopentyl)-2-fluoro-benzamide is a chemical compound characterized by its unique structural features, which include a benzamide core substituted with a fluorine atom and a cyanocyclopentyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The cyanocyclopentyl moiety introduces a cyclic structure that can affect the compound's conformation and interactions with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 912771-07-4, allows for easy identification and retrieval of information regarding its synthesis, properties, and potential applications. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.
Formula:C13H13FN2O
InChI:InChI=1/C13H13FN2O/c14-11-6-2-1-5-10(11)12(17)16-13(9-15)7-3-4-8-13/h1-2,5-6H,3-4,7-8H2,(H,16,17)
SMILES:c1ccc(c(c1)C(=NC1(CCCC1)C#N)O)F
Synonyms:
  • benzamide, N-(1-cyanocyclopentyl)-2-fluoro-
  • N-(1-Cyancyclopentyl)-2-fluorbenzamid
  • N-(1-cyanocyclopentyl)-2-fluorobenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.