CymitQuimica logo

CAS 912771-10-9

:

N-(1-cyanocyclohexyl)-2-fluorobenzamide

Description:
N-(1-cyanocyclohexyl)-2-fluorobenzamide is a chemical compound characterized by its unique structure, which includes a benzamide moiety substituted with a fluorine atom and a cyanocyclohexyl group. This compound features a cyanide functional group attached to a cyclohexane ring, contributing to its potential reactivity and biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and varying stability depending on environmental conditions. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the benzamide structure can lead to diverse biological activities. As with many synthetic organic compounds, safety and handling precautions are essential due to the presence of the cyanide group, which is toxic. Overall, N-(1-cyanocyclohexyl)-2-fluorobenzamide represents a class of compounds that may be of interest in research and development within the fields of chemistry and pharmacology.
Formula:C14H15FN2O
InChI:InChI=1/C14H15FN2O/c15-12-7-3-2-6-11(12)13(18)17-14(10-16)8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2,(H,17,18)
SMILES:C1CCC(CC1)(C#N)N=C(c1ccccc1F)O
Synonyms:
  • benzamide, N-(1-cyanocyclohexyl)-2-fluoro-
  • N-(1-Cyancyclohexyl)-2-fluorbenzamid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.