CymitQuimica logo

CAS 912771-12-1

:

N-(1-Cyanocycloheptyl)-2-fluorobenzamide

Description:
N-(1-Cyanocycloheptyl)-2-fluorobenzamide is a chemical compound characterized by its unique structural features, which include a fluorobenzamide moiety and a cyanocycloheptyl group. The presence of the fluorine atom on the benzene ring enhances the compound's lipophilicity and may influence its biological activity. The cyanocycloheptyl group contributes to the compound's steric and electronic properties, potentially affecting its interaction with biological targets. This compound is likely to exhibit moderate to high stability under standard conditions, although specific stability data would depend on environmental factors such as temperature and pH. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Additionally, the presence of both a cyano and a fluorine substituent may impart unique reactivity patterns, making it of interest in synthetic organic chemistry. As with any chemical substance, proper handling and safety precautions should be observed, given the potential hazards associated with its components.
Formula:C15H17FN2O
InChI:InChI=1/C15H17FN2O/c16-13-8-4-3-7-12(13)14(19)18-15(11-17)9-5-1-2-6-10-15/h3-4,7-8H,1-2,5-6,9-10H2,(H,18,19)
InChI key:InChIKey=ASKWZHHUORTCSK-UHFFFAOYSA-N
SMILES:N(C(=O)C1=C(F)C=CC=C1)C2(C#N)CCCCCC2
Synonyms:
  • benzamide, N-(1-cyanocycloheptyl)-2-fluoro-
  • N-(1-Cyancycloheptyl)-2-fluorbenzamid
  • N-(1-cyanocycloheptyl)-2-fluorobenzamide
  • N-(1-CYANO-CYCLOHEPTYL)-2-FLUORO-BENZAMIDE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.