CAS 912771-16-5

1-[(3-Fluorobenzoyl)amino]cyclohexanecarboxylic acid

Description:

1-[(3-Fluorobenzoyl)amino]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with a carboxylic acid group and an amino group linked to a 3-fluorobenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. As an amino acid derivative, it may participate in various chemical reactions, including peptide bond formation. The carboxylic acid group provides acidic properties, while the amino group can act as a base, allowing for potential zwitterionic behavior in solution. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with specific biological pathways. Its CAS number, 912771-16-5, allows for easy identification and reference in chemical databases and literature.

Formula: C₁₄H₁₆FNO₃

InChI: InChI=1S/C14H16FNO3/c15-11-6-4-5-10(9-11)12(17)16-14(13(18)19)7-2-1-3-8-14/h4-6,9H,1-3,7-8H2,(H,16,17)(H,18,19)

InChI key: InChIKey=KABLJMPPQSZGPB-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(F)=CC=C1)C2(C(O)=O)CCCCC2

Synonyms:

• 1-(3-Fluorobenzamido)cyclohexane-1-carboxylic acid
• 1-[(3-Fluorobenzoyl)amino]cyclohexanecarboxylic acid
• Acide 1-[(3-fluorobenzoyl)amino]cyclohexanecarboxylique
• Cyclohexanecarboxylic Acid, 1-[(3-Fluorobenzoyl)Amino]-
• 1-[(3-Fluorobenzoyl)amino]cyclohexane-1-carboxylic acid