CymitQuimica logo

CAS 912771-18-7

:

1-[(3-Fluorobenzoyl)amino]cycloheptanecarboxylic acid

Description:
1-[(3-Fluorobenzoyl)amino]cycloheptanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cycloheptane ring substituted with both an amino group and a carboxylic acid group, as well as a 3-fluorobenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the fluorine atom in the benzoyl group can influence the compound's electronic properties, potentially enhancing its biological activity or interaction with other molecules. The amino and carboxylic acid functional groups suggest that this compound may engage in hydrogen bonding, which can affect its solubility in polar solvents. Additionally, the cycloheptane structure may impart unique steric and conformational properties, influencing its behavior in various chemical environments. Overall, this compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities would require further investigation.
Formula:C15H18FNO3
InChI:InChI=1S/C15H18FNO3/c16-12-7-5-6-11(10-12)13(18)17-15(14(19)20)8-3-1-2-4-9-15/h5-7,10H,1-4,8-9H2,(H,17,18)(H,19,20)
InChI key:InChIKey=CYOXXKKBLPKXAR-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC(F)=CC=C1)C2(C(O)=O)CCCCCC2
Synonyms:
  • 1-(3-Fluorobenzamido)cycloheptane-1-carboxylic acid
  • 1-[(3-Fluorobenzoyl)amino]cycloheptanecarboxylic acid
  • Acide 1-[(3-fluorobenzoyl)amino]cycloheptanecarboxylique
  • Cycloheptanecarboxylic Acid, 1-[(3-Fluorobenzoyl)Amino]-
  • 1-[(3-Fluorobenzoyl)amino]cycloheptane-1-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.