CAS 912771-20-1

1-[(2-Fluorobenzoyl)amino]cyclopentanecarboxylic acid

Description:

1-[(2-Fluorobenzoyl)amino]cyclopentanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopentane ring substituted with a carboxylic acid group and an amino group linked to a 2-fluorobenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in polar solvents due to the presence of the carboxylic acid and amino functional groups. The fluorine atom in the 2-fluorobenzoyl group can influence the compound's electronic properties, potentially enhancing its reactivity or biological activity. The presence of the cyclopentane ring contributes to its three-dimensional conformation, which may affect its interactions in biological systems or in synthetic applications. As with many compounds containing both amine and carboxylic acid functionalities, it may exhibit zwitterionic behavior under certain conditions. Overall, this compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.

Formula: C₁₃H₁₄FNO₃

InChI: InChI=1S/C13H14FNO3/c14-10-6-2-1-5-9(10)11(16)15-13(12(17)18)7-3-4-8-13/h1-2,5-6H,3-4,7-8H2,(H,15,16)(H,17,18)

InChI key: InChIKey=IFSONEMYXXNOCA-UHFFFAOYSA-N

SMILES: N(C(=O)C1=C(F)C=CC=C1)C2(C(O)=O)CCCC2

Synonyms:

• 1-[(2-Fluorobenzoyl)amino]cyclopentanecarboxylic acid
• Acide 1-[(2-fluorobenzoyl)amino]cyclopentanecarboxylique
• Cyclopentanecarboxylic Acid, 1-[(2-Fluorobenzoyl)Amino]-

1-(2-Fluorobenzamido)cyclopentanecarboxylic acid

CAS: 912771-20-1

Formula: C₁₃H₁₄FNO₃

Molecular weight: 251.2536

Ref: IN-DA00GVB8