CymitQuimica logo

CAS 912771-23-4

:

1-[(2-fluorobenzoyl)amino]cyclohexane-1-carboxylic acid

Description:
1-[(2-Fluorobenzoyl)amino]cyclohexane-1-carboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with a carboxylic acid group and an amino group linked to a 2-fluorobenzoyl moiety. This compound exhibits properties typical of both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the fluorine atom in the benzoyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. The carboxylic acid functional group provides acidic characteristics, allowing for hydrogen bonding and solubility in polar solvents. Additionally, the amino group can participate in various chemical reactions, including amide formation and nucleophilic substitutions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental methods.
Formula:C14H16FNO3
InChI:InChI=1/C14H16FNO3/c15-11-7-3-2-6-10(11)12(17)16-14(13(18)19)8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2,(H,16,17)(H,18,19)
SMILES:C1CCC(CC1)(C(=O)O)N=C(c1ccccc1F)O
Synonyms:
  • 1-[(2-Fluorobenzoyl)amino]cyclohexanecarboxylic acid
  • Acide 1-[(2-fluorobenzoyl)amino]cyclohexanecarboxylique
  • Cyclohexanecarboxylic Acid, 1-[(2-Fluorobenzoyl)Amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.