CAS 912771-25-6
:5,6-Dihydroimidazo[2,1-b]thiazole-3-methanamine
Description:
5,6-Dihydroimidazo[2,1-b]thiazole-3-methanamine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential biological activity and solubility in polar solvents. The presence of the methanamine group suggests that it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. The compound's structure allows for various functional modifications, which can enhance its pharmacological properties. It may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential role as a scaffold for drug design. Additionally, the compound's CAS number, 912771-25-6, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical databases. Overall, 5,6-Dihydroimidazo[2,1-b]thiazole-3-methanamine represents a class of compounds that may possess significant therapeutic potential, warranting further investigation into its biological activities and applications.
Formula:C6H9N3S
InChI:InChI=1S/C6H9N3S/c7-3-5-4-10-6-8-1-2-9(5)6/h4H,1-3,7H2
InChI key:InChIKey=KLSGPRPKBJAGET-UHFFFAOYSA-N
SMILES:C(N)C=1N2C(SC1)=NCC2
Synonyms:- 1-(5,6-Dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-methanamine
- 5,6-Dihydroimidazo[2,1-b]thiazole-3-methanamine
- Imidazo[2,1-b]thiazole-3-methanamine, 5,6-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.