CAS 912771-26-7

1-[(2-fluorobenzoyl)amino]cycloheptane-1-carboxylic acid

Description:

1-[(2-Fluorobenzoyl)amino]cycloheptane-1-carboxylic acid is an organic compound characterized by its unique structure, which includes a cycloheptane ring, an amino group, and a carboxylic acid functional group. The presence of the 2-fluorobenzoyl moiety introduces both a fluorine atom and an aromatic ring, contributing to the compound's potential reactivity and biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic portion may enhance lipophilicity. The amino group can participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, the fluorine atom may affect the compound's electronic properties, potentially enhancing its binding affinity to biological targets. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₅H₁₈FNO₃

InChI: InChI=1/C15H18FNO3/c16-12-8-4-3-7-11(12)13(18)17-15(14(19)20)9-5-1-2-6-10-15/h3-4,7-8H,1-2,5-6,9-10H2,(H,17,18)(H,19,20)

SMILES: C1CCCC(CC1)(C(=O)O)N=C(c1ccccc1F)O

Synonyms:

• 1-[(2-Fluorobenzoyl)amino]cycloheptanecarboxylic acid
• Acide 1-[(2-fluorobenzoyl)amino]cycloheptanecarboxylique
• Cycloheptanecarboxylic Acid, 1-[(2-Fluorobenzoyl)Amino]-