CAS 912771-40-5
:N-(5-Bromo-2-pyrazinyl)thiourea
Description:
N-(5-Bromo-2-pyrazinyl)thiourea is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a bromine atom and a thiourea functional group. This compound typically exhibits properties associated with both heterocyclic compounds and thioureas, such as potential biological activity and reactivity due to the presence of the thiourea moiety. The bromine substitution can enhance its reactivity and influence its interaction with biological targets. N-(5-Bromo-2-pyrazinyl)thiourea may be utilized in various applications, including medicinal chemistry, where it could serve as a lead compound for the development of pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the compound's synthesis often involves straightforward methods, making it accessible for research purposes. As with many chemical substances, safety precautions should be observed when handling this compound due to potential toxicity and reactivity.
Formula:C5H5BrN4S
InChI:InChI=1S/C5H5BrN4S/c6-3-1-9-4(2-8-3)10-5(7)11/h1-2H,(H3,7,9,10,11)
InChI key:InChIKey=QSWSDHQPFQGJMU-UHFFFAOYSA-N
SMILES:N(C(N)=S)C=1C=NC(Br)=CN1
Synonyms:- 1-(5-Brom-2-pyrazinyl)thioharnstoff
- 1-(5-Bromo-2-pyrazinyl)thiourea
- 1-(5-Bromopyrazin-2-yl)thiourea
- N-(5-Bromo-2-pyrazinyl)thiourea
- Thiourea, (5-bromopyrazinyl)-
- thiourea, N-(5-bromo-2-pyrazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
