
CAS 912773-00-3
:3-Nitro-4-(1H-1,2,4-triazol-1-yl)pyridine
Description:
3-Nitro-4-(1H-1,2,4-triazol-1-yl)pyridine is a chemical compound characterized by its pyridine ring substituted with a nitro group and a triazole moiety. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions. The triazole ring contributes to the compound's biological activity, often enhancing its ability to interact with biological targets, which may be relevant in pharmaceutical applications. This compound is likely to exhibit moderate to high solubility in polar solvents due to its functional groups. Additionally, the presence of both the nitro and triazole groups suggests potential applications in agrochemicals or as a building block in organic synthesis. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks. Overall, 3-Nitro-4-(1H-1,2,4-triazol-1-yl)pyridine is a versatile compound with potential applications in various fields, including medicinal chemistry and material science.
Formula:C7H5N5O2
InChI:InChI=1S/C7H5N5O2/c13-12(14)7-3-8-2-1-6(7)11-5-9-4-10-11/h1-5H
InChI key:InChIKey=FBZATUUQBBCYOM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(=CC=NC1)N2C=NC=N2
Synonyms:- 3-Nitro-4-(1H-1,2,4-triazol-1-yl)pyridine
- Pyridine, 3-nitro-4-(1H-1,2,4-triazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.