CymitQuimica logo

CAS 912773-09-2

:

5-Bromo-N~3~,N~3~-diethylpyrazine-2,3-diamine

Description:
5-Bromo-N~3~,N~3~-diethylpyrazine-2,3-diamine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of bromine at the 5-position and diethyl groups at the N~3 and N~3 positions contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The presence of amine groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Safety data should be consulted for handling, as halogenated compounds can pose various health risks. Overall, 5-Bromo-N~3~,N~3~-diethylpyrazine-2,3-diamine is a versatile compound with applications in chemical synthesis and biological research.
Formula:C8H13BrN4
InChI:InChI=1/C8H13BrN4/c1-3-13(4-2)8-7(10)11-5-6(9)12-8/h5H,3-4H2,1-2H3,(H2,10,11)
SMILES:CCN(CC)c1c(N)ncc(Br)n1
Synonyms:
  • 2,3-pyrazinediamine, 5-bromo-N3
  • 5-Bromo-N3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.