CAS 912773-18-3
:N,N-Diethylpyrazine-2,3-diamine
Description:
N,N-Diethylpyrazine-2,3-diamine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features two ethyl groups attached to the nitrogen atoms at the N,N-positions and amino groups at the 2 and 3 positions of the pyrazine ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The compound may possess biological activity, making it of interest in pharmaceutical research. Its chemical properties include potential reactivity due to the amino groups, which can participate in various chemical reactions, such as acylation or alkylation. Additionally, the presence of the pyrazine moiety may contribute to its aromaticity and stability. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14N4
InChI:InChI=1/C8H14N4/c1-3-12(4-2)8-7(9)10-5-6-11-8/h5-6H,3-4H2,1-2H3,(H2,9,10)
Synonyms:- 2,3-pyrazinediamine, N< sup> 2< /sup> ,N< sup> 2< /sup> -diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
