CAS 912773-21-8

2-bromo-5-chloro-pyrazine

Description:

2-Bromo-5-chloro-pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at opposite positions. This compound features a bromine atom at the 2-position and a chlorine atom at the 5-position of the pyrazine ring, contributing to its reactivity and potential applications in various chemical reactions. It is typically a colorless to pale yellow solid, exhibiting moderate solubility in organic solvents. The presence of halogen substituents often enhances the compound's utility in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2-bromo-5-chloro-pyrazine may participate in nucleophilic substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, its unique structure and reactivity profile make it an interesting compound for research and industrial applications.

Formula: C₄H₂BrClN₂

InChI: InChI=1/C4H2BrClN2/c5-3-1-8-4(6)2-7-3/h1-2H

SMILES: c1c(Br)ncc(Cl)n1

2-Bromo-5-chloropyrazine

CAS: 912773-21-8

Formula: C₄H₂BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 193.4291

Ref: IN-DA0036UR

2-Bromo-5-chloropyrazine

CAS: 912773-21-8

2-Bromo-5-chloropyrazine

Purity: 97%

Color and Shape: Low-Melting Solid

Molecular weight: 193.43g/mol

Ref: 54-OR60106

2-Bromo-5-chloropyrazine

CAS: 912773-21-8

Purity: 98%

Molecular weight: 193.429

Ref: FT-B11626

2-Bromo-5-chloropyrazine

CAS: 912773-21-8

Formula: C₄H₂BrClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 193.43

Ref: 10-F077094