CAS 912773-24-1

2-Bromopyrazino [4,5-a] pyrole

Description:

2-Bromopyrazino[4,5-a]pyrole is a heterocyclic organic compound characterized by its unique structure, which includes a pyrazine ring fused to a pyrole moiety. This compound typically exhibits properties common to halogenated heterocycles, such as increased reactivity due to the presence of the bromine atom, which can participate in various substitution reactions. The presence of both nitrogen atoms in the pyrazine and pyrole rings contributes to its potential basicity and ability to form coordination complexes. Additionally, 2-Bromopyrazino[4,5-a]pyrole may display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in synthesis and biological assays. Overall, this compound's unique structural features and reactivity profile make it a valuable candidate for further research in various chemical and pharmaceutical applications.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-4-10-2-1-8-6(10)3-9-5/h1-4H

SMILES: c1cn2cc(Br)ncc2n1

Synonyms:

• 6-Bromoimidazo[1,2-A]Pyrazine
• 2-Bromopyrazino[4,5-A]Pyrole

6-Bromoimidazo[1,2-a]pyrazine

CAS: 912773-24-1

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA003N4S

6-Bromoimidazo[1,2-a]pyrazine

CAS: 912773-24-1

Purity: 95%

Molecular weight: 198.02

Ref: FT-B12874

6-Bromoimidazo[1,2-a]pyrazine

CAS: 912773-24-1

6-Bromoimidazo[1,2-a]pyrazine

Purity: 97%

Molecular weight: 198.02g/mol

Ref: 54-OR30553

6-Bromoimidazo[1,2-a]pyrazine

CAS: 912773-24-1

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F067619